About 4-methylbenzenesulfinic acid;tetrahydrate
4-methylbenzenesulfinic acid;tetrahydrate (PubChem CID 155656454) has the molecular formula C7H16O6S
and a molecular weight of 228.27 g/mol. Its IUPAC name is 4-methylbenzenesulfinic acid;tetrahydrate.
Molecular Properties
| Compound Name | 4-methylbenzenesulfinic acid;tetrahydrate |
| PubChem CID | 155656454 |
| Molecular Formula | C7H16O6S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 4-methylbenzenesulfinic acid;tetrahydrate |
| SMILES | Cc1ccc(S(=O)O)cc1.O.O.O.O |
| InChI | InChI=1S/C7H8O2S.4H2O/c1-6-2-4-7(5-3-6)10(8)9;;;;/h2-5H,1H3,(H,8,9);4*1H2 |
| InChIKey | ZCGQUWCOHLUQRA-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 163.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfinic acid;tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfinic acid;tetrahydrate?
The IUPAC name of 4-methylbenzenesulfinic acid;tetrahydrate (CID 155656454) is 4-methylbenzenesulfinic acid;tetrahydrate.
What is the SMILES notation for 4-methylbenzenesulfinic acid;tetrahydrate?
The canonical SMILES for 4-methylbenzenesulfinic acid;tetrahydrate is Cc1ccc(S(=O)O)cc1.O.O.O.O.
What is the InChIKey of 4-methylbenzenesulfinic acid;tetrahydrate?
The InChIKey is ZCGQUWCOHLUQRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2S.4H2O/c1-6-2-4-7(5-3-6)10(8)9;;;;/h2-5H,1H3,(H,8,9);4*1H2.
What are the key properties of 4-methylbenzenesulfinic acid;tetrahydrate?
4-methylbenzenesulfinic acid;tetrahydrate has a molecular weight of 228.27 g/mol, XLogP of -1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfinic acid;tetrahydrate is sourced from PubChem (CID 155656454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).