About CID 11594983
CID 11594983 (PubChem CID 11594983) has the molecular formula C12H11OS
and a molecular weight of 203.29 g/mol.
Molecular Properties
| Compound Name | CID 11594983 |
| PubChem CID | 11594983 |
| Molecular Formula | C12H11OS |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)C2=CC=C[CH]2)cc1 |
| InChI | InChI=1S/C12H11OS/c1-10-6-8-12(9-7-10)14(13)11-4-2-3-5-11/h2-9H,1H3 |
| InChIKey | IFUNUOSJMHSIQU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 11594983 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11594983?
The IUPAC name of CID 11594983 (CID 11594983) is not available.
What is the SMILES notation for CID 11594983?
The canonical SMILES for CID 11594983 is Cc1ccc(S(=O)C2=CC=C[CH]2)cc1.
What is the InChIKey of CID 11594983?
The InChIKey is IFUNUOSJMHSIQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11OS/c1-10-6-8-12(9-7-10)14(13)11-4-2-3-5-11/h2-9H,1H3.
What are the key properties of CID 11594983?
CID 11594983 has a molecular weight of 203.29 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11594983 is sourced from PubChem (CID 11594983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).