About 4-methylbenzenesulfinic acid;phenylhydrazine
4-methylbenzenesulfinic acid;phenylhydrazine (PubChem CID 121004211) has the molecular formula C13H16N2O2S
and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-methylbenzenesulfinic acid;phenylhydrazine.
Molecular Properties
| Compound Name | 4-methylbenzenesulfinic acid;phenylhydrazine |
| PubChem CID | 121004211 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 4-methylbenzenesulfinic acid;phenylhydrazine |
| SMILES | Cc1ccc(S(=O)O)cc1.NNc1ccccc1 |
| InChI | InChI=1S/C7H8O2S.C6H8N2/c1-6-2-4-7(5-3-6)10(8)9;7-8-6-4-2-1-3-5-6/h2-5H,1H3,(H,8,9);1-5,8H,7H2 |
| InChIKey | YDNJCGFNFQGUMK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfinic acid;phenylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfinic acid;phenylhydrazine?
The IUPAC name of 4-methylbenzenesulfinic acid;phenylhydrazine (CID 121004211) is 4-methylbenzenesulfinic acid;phenylhydrazine.
What is the SMILES notation for 4-methylbenzenesulfinic acid;phenylhydrazine?
The canonical SMILES for 4-methylbenzenesulfinic acid;phenylhydrazine is Cc1ccc(S(=O)O)cc1.NNc1ccccc1.
What is the InChIKey of 4-methylbenzenesulfinic acid;phenylhydrazine?
The InChIKey is YDNJCGFNFQGUMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2S.C6H8N2/c1-6-2-4-7(5-3-6)10(8)9;7-8-6-4-2-1-3-5-6/h2-5H,1H3,(H,8,9);1-5,8H,7H2.
What are the key properties of 4-methylbenzenesulfinic acid;phenylhydrazine?
4-methylbenzenesulfinic acid;phenylhydrazine has a molecular weight of 264.35 g/mol, XLogP of 2.55, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfinic acid;phenylhydrazine is sourced from PubChem (CID 121004211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).