C20H26O4S2 — CID 102094169
(2S,4R,5S)-1,5-bis[(4-methylphenyl)sulfinyl]hexane-2,4-diol (PubChem CID 102094169) has the molecular formula C20H26O4S2 and a molecular weight of 394.56 g/mol. Its IUPAC name is (2S,4R,5S)-1,5-bis[(4-methylphenyl)sulfinyl]hexane-2,4-diol.
| Compound Name | (2S,4R,5S)-1,5-bis[(4-methylphenyl)sulfinyl]hexane-2,4-diol |
|---|---|
| PubChem CID | 102094169 |
| Molecular Formula | C20H26O4S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (2S,4R,5S)-1,5-bis[(4-methylphenyl)sulfinyl]hexane-2,4-diol |
| SMILES | Cc1ccc(S(=O)C[C@@H](O)C[C@@H](O)[C@H](C)S(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H26O4S2/c1-14-4-8-18(9-5-14)25(23)13-17(21)12-20(22)16(3)26(24)19-10-6-15(2)7-11-19/h4-11,16-17,20-22H,12-13H2,1-3H3/t16-,17-,20+,25?,26?/m0/s1 |
| InChIKey | YNIOFXJDKQOUOX-JKSIKBPRSA-N |
| XLogP | 2.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |