C12H18O4S — CID 44545147
(2S,4R)-5-[(R)-(4-methylphenyl)sulfinyl]pentane-1,2,4-triol (PubChem CID 44545147) has the molecular formula C12H18O4S and a molecular weight of 258.34 g/mol. Its IUPAC name is (2S,4R)-5-[(R)-(4-methylphenyl)sulfinyl]pentane-1,2,4-triol.
| Compound Name | (2S,4R)-5-[(R)-(4-methylphenyl)sulfinyl]pentane-1,2,4-triol |
|---|---|
| PubChem CID | 44545147 |
| Molecular Formula | C12H18O4S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (2S,4R)-5-[(R)-(4-methylphenyl)sulfinyl]pentane-1,2,4-triol |
| SMILES | Cc1ccc([S@](=O)C[C@H](O)C[C@H](O)CO)cc1 |
| InChI | InChI=1S/C12H18O4S/c1-9-2-4-12(5-3-9)17(16)8-11(15)6-10(14)7-13/h2-5,10-11,13-15H,6-8H2,1H3/t10-,11+,17+/m0/s1 |
| InChIKey | QQBISVMICAOJAU-WVQJBOLRSA-N |
| XLogP | 0.21 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |