C14H18O2S — CID 10966931
(2S)-1-[(R)-(4-methylphenyl)sulfinyl]hept-3-yn-2-ol (PubChem CID 10966931) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is (2S)-1-[(R)-(4-methylphenyl)sulfinyl]hept-3-yn-2-ol.
| Compound Name | (2S)-1-[(R)-(4-methylphenyl)sulfinyl]hept-3-yn-2-ol |
|---|---|
| PubChem CID | 10966931 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (2S)-1-[(R)-(4-methylphenyl)sulfinyl]hept-3-yn-2-ol |
| SMILES | CCCC#C[C@H](O)C[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H18O2S/c1-3-4-5-6-13(15)11-17(16)14-9-7-12(2)8-10-14/h7-10,13,15H,3-4,11H2,1-2H3/t13-,17+/m0/s1 |
| InChIKey | DVZZRWJRHXESRM-SUMWQHHRSA-N |
| XLogP | 2.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|