C11H16O3S — CID 66220895
1-(2,2-dimethoxyethylsulfinyl)-4-methylbenzene (PubChem CID 66220895) has the molecular formula C11H16O3S and a molecular weight of 228.31 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethylsulfinyl)-4-methylbenzene.
| Compound Name | 1-(2,2-dimethoxyethylsulfinyl)-4-methylbenzene |
|---|---|
| PubChem CID | 66220895 |
| Molecular Formula | C11H16O3S |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 1-(2,2-dimethoxyethylsulfinyl)-4-methylbenzene |
| SMILES | COC(CS(=O)c1ccc(C)cc1)OC |
| InChI | InChI=1S/C11H16O3S/c1-9-4-6-10(7-5-9)15(12)8-11(13-2)14-3/h4-7,11H,8H2,1-3H3 |
| InChIKey | JWFIIIYGHXOHGF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|