C19H24O2S — CID 101452810
(2S,3S)-2-methyl-1-(4-methylphenyl)sulfinyl-5-phenylpentan-3-ol (PubChem CID 101452810) has the molecular formula C19H24O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is (2S,3S)-2-methyl-1-(4-methylphenyl)sulfinyl-5-phenylpentan-3-ol.
| Compound Name | (2S,3S)-2-methyl-1-(4-methylphenyl)sulfinyl-5-phenylpentan-3-ol |
|---|---|
| PubChem CID | 101452810 |
| Molecular Formula | C19H24O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (2S,3S)-2-methyl-1-(4-methylphenyl)sulfinyl-5-phenylpentan-3-ol |
| SMILES | Cc1ccc(S(=O)C[C@@H](C)[C@@H](O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H24O2S/c1-15-8-11-18(12-9-15)22(21)14-16(2)19(20)13-10-17-6-4-3-5-7-17/h3-9,11-12,16,19-20H,10,13-14H2,1-2H3/t16-,19+,22?/m1/s1 |
| InChIKey | PJZJERUSHNHPKX-IDKMENSTSA-N |
| XLogP | 3.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |