C21H21NO3S2 — CID 100925407
N,4-dimethyl-N-[2-(4-methylphenyl)sulfinylphenyl]benzenesulfonamide (PubChem CID 100925407) has the molecular formula C21H21NO3S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is N,4-dimethyl-N-[2-(4-methylphenyl)sulfinylphenyl]benzenesulfonamide.
| Compound Name | N,4-dimethyl-N-[2-(4-methylphenyl)sulfinylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 100925407 |
| Molecular Formula | C21H21NO3S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | N,4-dimethyl-N-[2-(4-methylphenyl)sulfinylphenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)c2ccccc2N(C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H21NO3S2/c1-16-8-12-18(13-9-16)26(23)21-7-5-4-6-20(21)22(3)27(24,25)19-14-10-17(2)11-15-19/h4-15H,1-3H3 |
| InChIKey | NSYADGLXQRLCNL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |