C13H13ClN2O2S — CID 131843711
N-(2-chloro-3-pyridinyl)-N,4-dimethylbenzenesulfonamide (PubChem CID 131843711) has the molecular formula C13H13ClN2O2S and a molecular weight of 296.78 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 131843711 |
| Molecular Formula | C13H13ClN2O2S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2cccnc2Cl)cc1 |
| InChI | InChI=1S/C13H13ClN2O2S/c1-10-5-7-11(8-6-10)19(17,18)16(2)12-4-3-9-15-13(12)14/h3-9H,1-2H3 |
| InChIKey | QFYMDRSJHOOXHS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|