C18H18ClN5O3S — CID 108789287
N-(2-chloro-3-pyridinyl)-1-methyl-5-[methyl-(4-methylphenyl)sulfonylamino]pyrazole-4-carboxamide (PubChem CID 108789287) has the molecular formula C18H18ClN5O3S and a molecular weight of 419.89 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-1-methyl-5-[methyl-(4-methylphenyl)sulfonylamino]pyrazole-4-carboxamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-1-methyl-5-[methyl-(4-methylphenyl)sulfonylamino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 108789287 |
| Molecular Formula | C18H18ClN5O3S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-1-methyl-5-[methyl-(4-methylphenyl)sulfonylamino]pyrazole-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2c(C(=O)Nc3cccnc3Cl)cnn2C)cc1 |
| InChI | InChI=1S/C18H18ClN5O3S/c1-12-6-8-13(9-7-12)28(26,27)24(3)18-14(11-21-23(18)2)17(25)22-15-5-4-10-20-16(15)19/h4-11H,1-3H3,(H,22,25) |
| InChIKey | TWZSNKIYOLUGBU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|