C21H22N4O6S — CID 108802252
methyl 2-hydroxy-3-[[1-methyl-5-[methyl-(4-methylphenyl)sulfonylamino]pyrazole-4-carbonyl]amino]benzoate (PubChem CID 108802252) has the molecular formula C21H22N4O6S and a molecular weight of 458.50 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[[1-methyl-5-[methyl-(4-methylphenyl)sulfonylamino]pyrazole-4-carbonyl]amino]benzoate.
| Compound Name | methyl 2-hydroxy-3-[[1-methyl-5-[methyl-(4-methylphenyl)sulfonylamino]pyrazole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 108802252 |
| Molecular Formula | C21H22N4O6S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | methyl 2-hydroxy-3-[[1-methyl-5-[methyl-(4-methylphenyl)sulfonylamino]pyrazole-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cnn(C)c2N(C)S(=O)(=O)c2ccc(C)cc2)c1O |
| InChI | InChI=1S/C21H22N4O6S/c1-13-8-10-14(11-9-13)32(29,30)25(3)20-16(12-22-24(20)2)19(27)23-17-7-5-6-15(18(17)26)21(28)31-4/h5-12,26H,1-4H3,(H,23,27) |
| InChIKey | KMRFJSCTVCOSIU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|