C14H19NO6 — CID 24805796
ethyl (2S,3R)-3,5-dihydroxy-2-(4-methoxyanilino)-4-oxopentanoate (PubChem CID 24805796) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is ethyl (2S,3R)-3,5-dihydroxy-2-(4-methoxyanilino)-4-oxopentanoate.
| Compound Name | ethyl (2S,3R)-3,5-dihydroxy-2-(4-methoxyanilino)-4-oxopentanoate |
|---|---|
| PubChem CID | 24805796 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | ethyl (2S,3R)-3,5-dihydroxy-2-(4-methoxyanilino)-4-oxopentanoate |
| SMILES | CCOC(=O)[C@@H](Nc1ccc(OC)cc1)[C@@H](O)C(=O)CO |
| InChI | InChI=1S/C14H19NO6/c1-3-21-14(19)12(13(18)11(17)8-16)15-9-4-6-10(20-2)7-5-9/h4-7,12-13,15-16,18H,3,8H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | ZHLTZTHFYJUWLI-STQMWFEESA-N |
| XLogP | -0.04 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|