C17H24ClNO4 — CID 90747812
ethyl (2R,3R)-3-acetyl-6-chloro-2-(4-methoxyanilino)hexanoate (PubChem CID 90747812) has the molecular formula C17H24ClNO4 and a molecular weight of 341.84 g/mol. Its IUPAC name is ethyl (2R,3R)-3-acetyl-6-chloro-2-(4-methoxyanilino)hexanoate.
| Compound Name | ethyl (2R,3R)-3-acetyl-6-chloro-2-(4-methoxyanilino)hexanoate |
|---|---|
| PubChem CID | 90747812 |
| Molecular Formula | C17H24ClNO4 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | ethyl (2R,3R)-3-acetyl-6-chloro-2-(4-methoxyanilino)hexanoate |
| SMILES | CCOC(=O)[C@H](Nc1ccc(OC)cc1)[C@@H](CCCCl)C(C)=O |
| InChI | InChI=1S/C17H24ClNO4/c1-4-23-17(21)16(15(12(2)20)6-5-11-18)19-13-7-9-14(22-3)10-8-13/h7-10,15-16,19H,4-6,11H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | NAKZUTZGXLTPQQ-JKSUJKDBSA-N |
| XLogP | 3.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|