C30H41NO5 — CID 101452633
methyl 4-[3-[2-ethoxy-1-(4-methoxyanilino)-2-oxoethyl]-5-ethylnon-1-en-2-yl]benzoate (PubChem CID 101452633) has the molecular formula C30H41NO5 and a molecular weight of 495.66 g/mol. Its IUPAC name is methyl 4-[3-[2-ethoxy-1-(4-methoxyanilino)-2-oxoethyl]-5-ethylnon-1-en-2-yl]benzoate.
| Compound Name | methyl 4-[3-[2-ethoxy-1-(4-methoxyanilino)-2-oxoethyl]-5-ethylnon-1-en-2-yl]benzoate |
|---|---|
| PubChem CID | 101452633 |
| Molecular Formula | C30H41NO5 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | methyl 4-[3-[2-ethoxy-1-(4-methoxyanilino)-2-oxoethyl]-5-ethylnon-1-en-2-yl]benzoate |
| SMILES | C=C(c1ccc(C(=O)OC)cc1)C(CC(CC)CCCC)C(Nc1ccc(OC)cc1)C(=O)OCC |
| InChI | InChI=1S/C30H41NO5/c1-7-10-11-22(8-2)20-27(21(4)23-12-14-24(15-13-23)29(32)35-6)28(30(33)36-9-3)31-25-16-18-26(34-5)19-17-25/h12-19,22,27-28,31H,4,7-11,20H2,1-3,5-6H3 |
| InChIKey | QFEBAOZSLJPFRZ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|