C26H33NO7 — CID 101452632
methyl 4-[5-ethoxy-4-(4-methoxyanilino)-3-[2-(methoxymethoxy)ethyl]-5-oxopent-1-en-2-yl]benzoate (PubChem CID 101452632) has the molecular formula C26H33NO7 and a molecular weight of 471.55 g/mol. Its IUPAC name is methyl 4-[5-ethoxy-4-(4-methoxyanilino)-3-[2-(methoxymethoxy)ethyl]-5-oxopent-1-en-2-yl]benzoate.
| Compound Name | methyl 4-[5-ethoxy-4-(4-methoxyanilino)-3-[2-(methoxymethoxy)ethyl]-5-oxopent-1-en-2-yl]benzoate |
|---|---|
| PubChem CID | 101452632 |
| Molecular Formula | C26H33NO7 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | methyl 4-[5-ethoxy-4-(4-methoxyanilino)-3-[2-(methoxymethoxy)ethyl]-5-oxopent-1-en-2-yl]benzoate |
| SMILES | C=C(c1ccc(C(=O)OC)cc1)C(CCOCOC)C(Nc1ccc(OC)cc1)C(=O)OCC |
| InChI | InChI=1S/C26H33NO7/c1-6-34-26(29)24(27-21-11-13-22(31-4)14-12-21)23(15-16-33-17-30-3)18(2)19-7-9-20(10-8-19)25(28)32-5/h7-14,23-24,27H,2,6,15-17H2,1,3-5H3 |
| InChIKey | DBHBEKYVWNJIIP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|