C14H14O7 — CID 2752718
dimethyl 6-methoxy-1-oxo-4H-isochromene-3,3-dicarboxylate (PubChem CID 2752718) has the molecular formula C14H14O7 and a molecular weight of 294.26 g/mol. Its IUPAC name is dimethyl 6-methoxy-1-oxo-4H-isochromene-3,3-dicarboxylate.
| Compound Name | dimethyl 6-methoxy-1-oxo-4H-isochromene-3,3-dicarboxylate |
|---|---|
| PubChem CID | 2752718 |
| Molecular Formula | C14H14O7 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | dimethyl 6-methoxy-1-oxo-4H-isochromene-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc(OC)ccc2C(=O)O1 |
| InChI | InChI=1S/C14H14O7/c1-18-9-4-5-10-8(6-9)7-14(12(16)19-2,13(17)20-3)21-11(10)15/h4-6H,7H2,1-3H3 |
| InChIKey | PUGPVKSFJRZFKB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|