C20H21NO4 — CID 4906092
6-ethyl-N-(4-methoxyphenyl)-3-methyl-1-oxo-4H-isochromene-3-carboxamide (PubChem CID 4906092) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 6-ethyl-N-(4-methoxyphenyl)-3-methyl-1-oxo-4H-isochromene-3-carboxamide.
| Compound Name | 6-ethyl-N-(4-methoxyphenyl)-3-methyl-1-oxo-4H-isochromene-3-carboxamide |
|---|---|
| PubChem CID | 4906092 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 6-ethyl-N-(4-methoxyphenyl)-3-methyl-1-oxo-4H-isochromene-3-carboxamide |
| SMILES | CCc1ccc2c(c1)CC(C)(C(=O)Nc1ccc(OC)cc1)OC2=O |
| InChI | InChI=1S/C20H21NO4/c1-4-13-5-10-17-14(11-13)12-20(2,25-18(17)22)19(23)21-15-6-8-16(24-3)9-7-15/h5-11H,4,12H2,1-3H3,(H,21,23) |
| InChIKey | BZYCKJQXLSJFOA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |