C41H37N3O8 — CID 5199772
dimethyl 2-[(9-phenylfluoren-9-yl)amino]-3-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]butanedioate (PubChem CID 5199772) has the molecular formula C41H37N3O8 and a molecular weight of 699.76 g/mol. Its IUPAC name is dimethyl 2-[(9-phenylfluoren-9-yl)amino]-3-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]butanedioate.
| Compound Name | dimethyl 2-[(9-phenylfluoren-9-yl)amino]-3-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]butanedioate |
|---|---|
| PubChem CID | 5199772 |
| Molecular Formula | C41H37N3O8 |
| Molecular Weight | 699.76 g/mol |
| Exact Mass | 699.26 |
| IUPAC Name | dimethyl 2-[(9-phenylfluoren-9-yl)amino]-3-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]butanedioate |
| SMILES | COC(=O)C(NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(C(=O)OC)N(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H37N3O8/c1-49-37(45)35(42-41(30-20-10-5-11-21-30)33-24-14-12-22-31(33)32-23-13-15-25-34(32)41)36(38(46)50-2)44(40(48)52-27-29-18-8-4-9-19-29)43-39(47)51-26-28-16-6-3-7-17-28/h3-25,35-36,42H,26-27H2,1-2H3,(H,43,47) |
| InChIKey | OYRSWVWOSZFOMX-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.76 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|