C24H24N2O2 — CID 142746764
4-hydroxy-3-methyl-2-[(9-phenylfluoren-9-yl)amino]butanamide (PubChem CID 142746764) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-hydroxy-3-methyl-2-[(9-phenylfluoren-9-yl)amino]butanamide.
| Compound Name | 4-hydroxy-3-methyl-2-[(9-phenylfluoren-9-yl)amino]butanamide |
|---|---|
| PubChem CID | 142746764 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 4-hydroxy-3-methyl-2-[(9-phenylfluoren-9-yl)amino]butanamide |
| SMILES | CC(CO)C(NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(N)=O |
| InChI | InChI=1S/C24H24N2O2/c1-16(15-27)22(23(25)28)26-24(17-9-3-2-4-10-17)20-13-7-5-11-18(20)19-12-6-8-14-21(19)24/h2-14,16,22,26-27H,15H2,1H3,(H2,25,28) |
| InChIKey | SRGIDOJPHAMAQL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |