C22H19NO2 — CID 22116668
2-[(9-phenylfluoren-9-yl)amino]propanoic acid (PubChem CID 22116668) has the molecular formula C22H19NO2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[(9-phenylfluoren-9-yl)amino]propanoic acid.
| Compound Name | 2-[(9-phenylfluoren-9-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 22116668 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-[(9-phenylfluoren-9-yl)amino]propanoic acid |
| SMILES | CC(NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C22H19NO2/c1-15(21(24)25)23-22(16-9-3-2-4-10-16)19-13-7-5-11-17(19)18-12-6-8-14-20(18)22/h2-15,23H,1H3,(H,24,25) |
| InChIKey | BIPTVPZFIZKZRT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |