C25H23NO5 — CID 10960718
dimethyl (2S,3S)-2-hydroxy-3-[(9-phenylfluoren-9-yl)amino]butanedioate (PubChem CID 10960718) has the molecular formula C25H23NO5 and a molecular weight of 417.46 g/mol. Its IUPAC name is dimethyl (2S,3S)-2-hydroxy-3-[(9-phenylfluoren-9-yl)amino]butanedioate.
| Compound Name | dimethyl (2S,3S)-2-hydroxy-3-[(9-phenylfluoren-9-yl)amino]butanedioate |
|---|---|
| PubChem CID | 10960718 |
| Molecular Formula | C25H23NO5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | dimethyl (2S,3S)-2-hydroxy-3-[(9-phenylfluoren-9-yl)amino]butanedioate |
| SMILES | COC(=O)[C@@H](O)[C@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(=O)OC |
| InChI | InChI=1S/C25H23NO5/c1-30-23(28)21(22(27)24(29)31-2)26-25(16-10-4-3-5-11-16)19-14-8-6-12-17(19)18-13-7-9-15-20(18)25/h3-15,21-22,26-27H,1-2H3/t21-,22-/m0/s1 |
| InChIKey | ASSNPIKIGAXTKJ-VXKWHMMOSA-N |
| XLogP | 2.62 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |