C30H31NO5 — CID 101072579
1-O-ethyl 5-O-methyl (4R)-4-[(9-phenylfluoren-9-yl)amino]-2-propanoylpentanedioate (PubChem CID 101072579) has the molecular formula C30H31NO5 and a molecular weight of 485.58 g/mol. Its IUPAC name is 1-O-ethyl 5-O-methyl (4R)-4-[(9-phenylfluoren-9-yl)amino]-2-propanoylpentanedioate.
| Compound Name | 1-O-ethyl 5-O-methyl (4R)-4-[(9-phenylfluoren-9-yl)amino]-2-propanoylpentanedioate |
|---|---|
| PubChem CID | 101072579 |
| Molecular Formula | C30H31NO5 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 1-O-ethyl 5-O-methyl (4R)-4-[(9-phenylfluoren-9-yl)amino]-2-propanoylpentanedioate |
| SMILES | CCOC(=O)C(C[C@@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(=O)OC)C(=O)CC |
| InChI | InChI=1S/C30H31NO5/c1-4-27(32)23(28(33)36-5-2)19-26(29(34)35-3)31-30(20-13-7-6-8-14-20)24-17-11-9-15-21(24)22-16-10-12-18-25(22)30/h6-18,23,26,31H,4-5,19H2,1-3H3/t23?,26-/m1/s1 |
| InChIKey | SDQGERPKGVQSRU-ANWICMFUSA-N |
| XLogP | 4.64 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|