C61H60N2O5 — CID 24939626
ditert-butyl (2S,6R,8S)-4-oxo-6-phenyl-2,8-bis[(9-phenylfluoren-9-yl)amino]nonanedioate (PubChem CID 24939626) has the molecular formula C61H60N2O5 and a molecular weight of 901.16 g/mol. Its IUPAC name is ditert-butyl (2S,6R,8S)-4-oxo-6-phenyl-2,8-bis[(9-phenylfluoren-9-yl)amino]nonanedioate.
| Compound Name | ditert-butyl (2S,6R,8S)-4-oxo-6-phenyl-2,8-bis[(9-phenylfluoren-9-yl)amino]nonanedioate |
|---|---|
| PubChem CID | 24939626 |
| Molecular Formula | C61H60N2O5 |
| Molecular Weight | 901.16 g/mol |
| Exact Mass | 900.45 |
| IUPAC Name | ditert-butyl (2S,6R,8S)-4-oxo-6-phenyl-2,8-bis[(9-phenylfluoren-9-yl)amino]nonanedioate |
| SMILES | CC(C)(C)OC(=O)[C@H](CC(=O)C[C@@H](C[C@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(=O)OC(C)(C)C)c1ccccc1)NC1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C61H60N2O5/c1-58(2,3)67-56(65)54(62-60(43-26-12-8-13-27-43)50-34-20-16-30-46(50)47-31-17-21-35-51(47)60)39-42(41-24-10-7-11-25-41)38-45(64)40-55(57(66)68-59(4,5)6)63-61(44-28-14-9-15-29-44)52-36-22-18-32-48(52)49-33-19-23-37-53(49)61/h7-37,42,54-55,62-63H,38-40H2,1-6H3/t42-,54-,55-/m0/s1 |
| InChIKey | JXAFDMZCGPWJHL-YBMRGQMESA-N |
| XLogP | 12.05 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.16 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |