C33H38N2O4 — CID 177457678
methyl (Z,2R)-3,3-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate (PubChem CID 177457678) has the molecular formula C33H38N2O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is methyl (Z,2R)-3,3-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate.
| Compound Name | methyl (Z,2R)-3,3-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate |
|---|---|
| PubChem CID | 177457678 |
| Molecular Formula | C33H38N2O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | methyl (Z,2R)-3,3-dimethyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate |
| SMILES | COC(=O)[C@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(C)(C)/C=C\CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H38N2O4/c1-31(2,3)39-30(37)34-22-14-21-32(4,5)28(29(36)38-6)35-33(23-15-8-7-9-16-23)26-19-12-10-17-24(26)25-18-11-13-20-27(25)33/h7-21,28,35H,22H2,1-6H3,(H,34,37)/b21-14-/t28-/m0/s1 |
| InChIKey | YSJXVKAQQYABPG-JGIZHUKKSA-N |
| XLogP | 6.20 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|