C29H25NO2 — CID 10669760
methyl (2S)-3-phenyl-2-[(9-phenylfluoren-9-yl)amino]propanoate (PubChem CID 10669760) has the molecular formula C29H25NO2 and a molecular weight of 419.52 g/mol. Its IUPAC name is methyl (2S)-3-phenyl-2-[(9-phenylfluoren-9-yl)amino]propanoate.
| Compound Name | methyl (2S)-3-phenyl-2-[(9-phenylfluoren-9-yl)amino]propanoate |
|---|---|
| PubChem CID | 10669760 |
| Molecular Formula | C29H25NO2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | methyl (2S)-3-phenyl-2-[(9-phenylfluoren-9-yl)amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H25NO2/c1-32-28(31)27(20-21-12-4-2-5-13-21)30-29(22-14-6-3-7-15-22)25-18-10-8-16-23(25)24-17-9-11-19-26(24)29/h2-19,27,30H,20H2,1H3/t27-/m0/s1 |
| InChIKey | RFEGUZUWRHIZGJ-MHZLTWQESA-N |
| XLogP | 5.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |