C31H27NO4 — CID 66648507
1-O-benzyl 4-O-methyl 2-[(9-phenylfluoren-9-yl)amino]butanedioate (PubChem CID 66648507) has the molecular formula C31H27NO4 and a molecular weight of 477.56 g/mol. Its IUPAC name is 1-O-benzyl 4-O-methyl 2-[(9-phenylfluoren-9-yl)amino]butanedioate.
| Compound Name | 1-O-benzyl 4-O-methyl 2-[(9-phenylfluoren-9-yl)amino]butanedioate |
|---|---|
| PubChem CID | 66648507 |
| Molecular Formula | C31H27NO4 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 1-O-benzyl 4-O-methyl 2-[(9-phenylfluoren-9-yl)amino]butanedioate |
| SMILES | COC(=O)CC(NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H27NO4/c1-35-29(33)20-28(30(34)36-21-22-12-4-2-5-13-22)32-31(23-14-6-3-7-15-23)26-18-10-8-16-24(26)25-17-9-11-19-27(25)31/h2-19,28,32H,20-21H2,1H3 |
| InChIKey | LXIZCLICHBNAFS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |