C36H36N2O3 — CID 59958820
benzyl (2S)-3-methyl-2-[2-[(9-phenylfluoren-9-yl)amino]pent-4-enoylamino]butanoate (PubChem CID 59958820) has the molecular formula C36H36N2O3 and a molecular weight of 544.70 g/mol. Its IUPAC name is benzyl (2S)-3-methyl-2-[2-[(9-phenylfluoren-9-yl)amino]pent-4-enoylamino]butanoate.
| Compound Name | benzyl (2S)-3-methyl-2-[2-[(9-phenylfluoren-9-yl)amino]pent-4-enoylamino]butanoate |
|---|---|
| PubChem CID | 59958820 |
| Molecular Formula | C36H36N2O3 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | benzyl (2S)-3-methyl-2-[2-[(9-phenylfluoren-9-yl)amino]pent-4-enoylamino]butanoate |
| SMILES | C=CCC(NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(=O)N[C@H](C(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C36H36N2O3/c1-4-15-32(34(39)37-33(25(2)3)35(40)41-24-26-16-7-5-8-17-26)38-36(27-18-9-6-10-19-27)30-22-13-11-20-28(30)29-21-12-14-23-31(29)36/h4-14,16-23,25,32-33,38H,1,15,24H2,2-3H3,(H,37,39)/t32?,33-/m0/s1 |
| InChIKey | FJRLKJSFZUQHRP-OBOZPERJSA-N |
| XLogP | 6.38 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|