C27H25NO4 — CID 11048212
dimethyl (Z,4S)-4-[(9-phenylfluoren-9-yl)amino]hex-2-enedioate (PubChem CID 11048212) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is dimethyl (Z,4S)-4-[(9-phenylfluoren-9-yl)amino]hex-2-enedioate.
| Compound Name | dimethyl (Z,4S)-4-[(9-phenylfluoren-9-yl)amino]hex-2-enedioate |
|---|---|
| PubChem CID | 11048212 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | dimethyl (Z,4S)-4-[(9-phenylfluoren-9-yl)amino]hex-2-enedioate |
| SMILES | COC(=O)/C=C\[C@H](CC(=O)OC)NC1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H25NO4/c1-31-25(29)17-16-20(18-26(30)32-2)28-27(19-10-4-3-5-11-19)23-14-8-6-12-21(23)22-13-7-9-15-24(22)27/h3-17,20,28H,18H2,1-2H3/b17-16-/t20-/m1/s1 |
| InChIKey | ICWDDZZKIFRTOO-UAMJFUFUSA-N |
| XLogP | 4.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|