C35H33NO3 — CID 10625676
tert-butyl (E,2S)-6-oxo-6-phenyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate (PubChem CID 10625676) has the molecular formula C35H33NO3 and a molecular weight of 515.65 g/mol. Its IUPAC name is tert-butyl (E,2S)-6-oxo-6-phenyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate.
| Compound Name | tert-butyl (E,2S)-6-oxo-6-phenyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate |
|---|---|
| PubChem CID | 10625676 |
| Molecular Formula | C35H33NO3 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | tert-butyl (E,2S)-6-oxo-6-phenyl-2-[(9-phenylfluoren-9-yl)amino]hex-4-enoate |
| SMILES | CC(C)(C)OC(=O)[C@H](C/C=C/C(=O)c1ccccc1)NC1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C35H33NO3/c1-34(2,3)39-33(38)31(23-14-24-32(37)25-15-6-4-7-16-25)36-35(26-17-8-5-9-18-26)29-21-12-10-19-27(29)28-20-11-13-22-30(28)35/h4-22,24,31,36H,23H2,1-3H3/b24-14+/t31-/m0/s1 |
| InChIKey | QIKPHBKHEMRTAK-IBYBCDFTSA-N |
| XLogP | 7.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|