C30H23FN2O6 — CID 162398665
benzyl N-[(3R)-3-(4-fluorophenyl)-2-oxo-1-benzofuran-3-yl]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 162398665) has the molecular formula C30H23FN2O6 and a molecular weight of 526.52 g/mol. Its IUPAC name is benzyl N-[(3R)-3-(4-fluorophenyl)-2-oxo-1-benzofuran-3-yl]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | benzyl N-[(3R)-3-(4-fluorophenyl)-2-oxo-1-benzofuran-3-yl]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 162398665 |
| Molecular Formula | C30H23FN2O6 |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | benzyl N-[(3R)-3-(4-fluorophenyl)-2-oxo-1-benzofuran-3-yl]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | O=C(NN(C(=O)OCc1ccccc1)[C@@]1(c2ccc(F)cc2)C(=O)Oc2ccccc21)OCc1ccccc1 |
| InChI | InChI=1S/C30H23FN2O6/c31-24-17-15-23(16-18-24)30(25-13-7-8-14-26(25)39-27(30)34)33(29(36)38-20-22-11-5-2-6-12-22)32-28(35)37-19-21-9-3-1-4-10-21/h1-18H,19-20H2,(H,32,35)/t30-/m1/s1 |
| InChIKey | QYCWTDGQDBICPH-SSEXGKCCSA-N |
| XLogP | 5.47 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|