C37H49ClN4O7 — CID 175380377
tert-butyl 4-[2-[[(3-chlorophenyl)methoxycarbonylamino]-(3-cyclohexylpropanoyl)amino]-5-oxopentanoyl]-2-phenylpiperazine-1-carboxylate (PubChem CID 175380377) has the molecular formula C37H49ClN4O7 and a molecular weight of 697.27 g/mol. Its IUPAC name is tert-butyl 4-[2-[[(3-chlorophenyl)methoxycarbonylamino]-(3-cyclohexylpropanoyl)amino]-5-oxopentanoyl]-2-phenylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[(3-chlorophenyl)methoxycarbonylamino]-(3-cyclohexylpropanoyl)amino]-5-oxopentanoyl]-2-phenylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 175380377 |
| Molecular Formula | C37H49ClN4O7 |
| Molecular Weight | 697.27 g/mol |
| Exact Mass | 696.33 |
| IUPAC Name | tert-butyl 4-[2-[[(3-chlorophenyl)methoxycarbonylamino]-(3-cyclohexylpropanoyl)amino]-5-oxopentanoyl]-2-phenylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)C(CCC=O)N(NC(=O)OCc2cccc(Cl)c2)C(=O)CCC2CCCCC2)CC1c1ccccc1 |
| InChI | InChI=1S/C37H49ClN4O7/c1-37(2,3)49-36(47)41-22-21-40(25-32(41)29-15-8-5-9-16-29)34(45)31(18-11-23-43)42(33(44)20-19-27-12-6-4-7-13-27)39-35(46)48-26-28-14-10-17-30(38)24-28/h5,8-10,14-17,23-24,27,31-32H,4,6-7,11-13,18-22,25-26H2,1-3H3,(H,39,46) |
| InChIKey | KTSDLFXLUWFHBG-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.27 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|