C19H28ClNO4 — CID 156857875
1-chloro-3-(methoxymethyl)benzene;3-cyclohexyl-2-[formyl(methyl)amino]propanoic acid (PubChem CID 156857875) has the molecular formula C19H28ClNO4 and a molecular weight of 369.89 g/mol. Its IUPAC name is 1-chloro-3-(methoxymethyl)benzene;3-cyclohexyl-2-[formyl(methyl)amino]propanoic acid.
| Compound Name | 1-chloro-3-(methoxymethyl)benzene;3-cyclohexyl-2-[formyl(methyl)amino]propanoic acid |
|---|---|
| PubChem CID | 156857875 |
| Molecular Formula | C19H28ClNO4 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-chloro-3-(methoxymethyl)benzene;3-cyclohexyl-2-[formyl(methyl)amino]propanoic acid |
| SMILES | CN(C=O)C(CC1CCCCC1)C(=O)O.COCc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H19NO3.C8H9ClO/c1-12(8-13)10(11(14)15)7-9-5-3-2-4-6-9;1-10-6-7-3-2-4-8(9)5-7/h8-10H,2-7H2,1H3,(H,14,15);2-5H,6H2,1H3 |
| InChIKey | VQBJKBUWHLVMQY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|