C31H42ClN3O8S — CID 156858027
(2R)-2-[[(2R)-2-[(3-chlorophenyl)methoxycarbonylamino]-3-cyclohexylpropanoyl]amino]-1-hydroxy-5-[methyl(2-phenylethyl)amino]-5-oxopentane-1-sulfonic acid (PubChem CID 156858027) has the molecular formula C31H42ClN3O8S and a molecular weight of 652.21 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-[(3-chlorophenyl)methoxycarbonylamino]-3-cyclohexylpropanoyl]amino]-1-hydroxy-5-[methyl(2-phenylethyl)amino]-5-oxopentane-1-sulfonic acid.
| Compound Name | (2R)-2-[[(2R)-2-[(3-chlorophenyl)methoxycarbonylamino]-3-cyclohexylpropanoyl]amino]-1-hydroxy-5-[methyl(2-phenylethyl)amino]-5-oxopentane-1-sulfonic acid |
|---|---|
| PubChem CID | 156858027 |
| Molecular Formula | C31H42ClN3O8S |
| Molecular Weight | 652.21 g/mol |
| Exact Mass | 651.24 |
| IUPAC Name | (2R)-2-[[(2R)-2-[(3-chlorophenyl)methoxycarbonylamino]-3-cyclohexylpropanoyl]amino]-1-hydroxy-5-[methyl(2-phenylethyl)amino]-5-oxopentane-1-sulfonic acid |
| SMILES | CN(CCc1ccccc1)C(=O)CC[C@@H](NC(=O)[C@@H](CC1CCCCC1)NC(=O)OCc1cccc(Cl)c1)C(O)S(=O)(=O)O |
| InChI | InChI=1S/C31H42ClN3O8S/c1-35(18-17-22-9-4-2-5-10-22)28(36)16-15-26(30(38)44(40,41)42)33-29(37)27(20-23-11-6-3-7-12-23)34-31(39)43-21-24-13-8-14-25(32)19-24/h2,4-5,8-10,13-14,19,23,26-27,30,38H,3,6-7,11-12,15-18,20-21H2,1H3,(H,33,37)(H,34,39)(H,40,41,42)/t26-,27-,30?/m1/s1 |
| InChIKey | WOJMPEXRKMRDGT-KXNYULQOSA-N |
| XLogP | 4.08 |
| TPSA | 162.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.21 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|