C28H42ClN3O6 — CID 168741334
[(2S)-2-[(3-chlorophenyl)methoxycarbonylamino]-3-cyclohexylpropanoyl] (2S)-2-amino-5-[methyl(pentyl)amino]-5-oxopentanoate (PubChem CID 168741334) has the molecular formula C28H42ClN3O6 and a molecular weight of 552.11 g/mol. Its IUPAC name is [(2S)-2-[(3-chlorophenyl)methoxycarbonylamino]-3-cyclohexylpropanoyl] (2S)-2-amino-5-[methyl(pentyl)amino]-5-oxopentanoate.
| Compound Name | [(2S)-2-[(3-chlorophenyl)methoxycarbonylamino]-3-cyclohexylpropanoyl] (2S)-2-amino-5-[methyl(pentyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 168741334 |
| Molecular Formula | C28H42ClN3O6 |
| Molecular Weight | 552.11 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | [(2S)-2-[(3-chlorophenyl)methoxycarbonylamino]-3-cyclohexylpropanoyl] (2S)-2-amino-5-[methyl(pentyl)amino]-5-oxopentanoate |
| SMILES | CCCCCN(C)C(=O)CC[C@H](N)C(=O)OC(=O)[C@H](CC1CCCCC1)NC(=O)OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C28H42ClN3O6/c1-3-4-8-16-32(2)25(33)15-14-23(30)26(34)38-27(35)24(18-20-10-6-5-7-11-20)31-28(36)37-19-21-12-9-13-22(29)17-21/h9,12-13,17,20,23-24H,3-8,10-11,14-16,18-19,30H2,1-2H3,(H,31,36)/t23-,24-/m0/s1 |
| InChIKey | JAZRMGZAMFMHJV-ZEQRLZLVSA-N |
| XLogP | 4.73 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.11 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|