C32H52ClN4O10P — CID 168741249
ethyl N-[2-[[(4S)-4-[[(2S)-2-[(3-chlorophenyl)methoxycarbonylamino]-3-cyclohexylpropanoyl]amino]-5-diethoxyphosphoryl-5-hydroxypentanoyl]-methylamino]ethyl]carbamate (PubChem CID 168741249) has the molecular formula C32H52ClN4O10P and a molecular weight of 719.21 g/mol. Its IUPAC name is ethyl N-[2-[[(4S)-4-[[(2S)-2-[(3-chlorophenyl)methoxycarbonylamino]-3-cyclohexylpropanoyl]amino]-5-diethoxyphosphoryl-5-hydroxypentanoyl]-methylamino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[[(4S)-4-[[(2S)-2-[(3-chlorophenyl)methoxycarbonylamino]-3-cyclohexylpropanoyl]amino]-5-diethoxyphosphoryl-5-hydroxypentanoyl]-methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 168741249 |
| Molecular Formula | C32H52ClN4O10P |
| Molecular Weight | 719.21 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | ethyl N-[2-[[(4S)-4-[[(2S)-2-[(3-chlorophenyl)methoxycarbonylamino]-3-cyclohexylpropanoyl]amino]-5-diethoxyphosphoryl-5-hydroxypentanoyl]-methylamino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCN(C)C(=O)CC[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)OCc1cccc(Cl)c1)C(O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C32H52ClN4O10P/c1-5-44-31(41)34-18-19-37(4)28(38)17-16-26(30(40)48(43,46-6-2)47-7-3)35-29(39)27(21-23-12-9-8-10-13-23)36-32(42)45-22-24-14-11-15-25(33)20-24/h11,14-15,20,23,26-27,30,40H,5-10,12-13,16-19,21-22H2,1-4H3,(H,34,41)(H,35,39)(H,36,42)/t26-,27-,30?/m0/s1 |
| InChIKey | KXEBAKIAIJNXRD-WPVVHWIUSA-N |
| XLogP | 4.96 |
| TPSA | 181.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.21 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|