C34H49ClN3O8P — CID 166748667
[(2S)-1-[[(2S)-5-[benzyl(methyl)amino]-1-diethoxyphosphoryl-1-hydroxy-5-oxopentan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl] N-[(3-chlorophenyl)methyl]carbamate (PubChem CID 166748667) has the molecular formula C34H49ClN3O8P and a molecular weight of 694.21 g/mol. Its IUPAC name is [(2S)-1-[[(2S)-5-[benzyl(methyl)amino]-1-diethoxyphosphoryl-1-hydroxy-5-oxopentan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl] N-[(3-chlorophenyl)methyl]carbamate.
| Compound Name | [(2S)-1-[[(2S)-5-[benzyl(methyl)amino]-1-diethoxyphosphoryl-1-hydroxy-5-oxopentan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl] N-[(3-chlorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 166748667 |
| Molecular Formula | C34H49ClN3O8P |
| Molecular Weight | 694.21 g/mol |
| Exact Mass | 693.29 |
| IUPAC Name | [(2S)-1-[[(2S)-5-[benzyl(methyl)amino]-1-diethoxyphosphoryl-1-hydroxy-5-oxopentan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl] N-[(3-chlorophenyl)methyl]carbamate |
| SMILES | CCOP(=O)(OCC)C(O)[C@H](CCC(=O)N(C)Cc1ccccc1)NC(=O)[C@H](CC1CCCCC1)OC(=O)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C34H49ClN3O8P/c1-4-44-47(43,45-5-2)33(41)29(19-20-31(39)38(3)24-26-15-10-7-11-16-26)37-32(40)30(22-25-13-8-6-9-14-25)46-34(42)36-23-27-17-12-18-28(35)21-27/h7,10-12,15-18,21,25,29-30,33,41H,4-6,8-9,13-14,19-20,22-24H2,1-3H3,(H,36,42)(H,37,40)/t29-,30-,33?/m0/s1 |
| InChIKey | GNOPJPZHUKATDB-BVKSZRQYSA-N |
| XLogP | 6.41 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.21 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|