C30H47ClN3O8P — CID 156883725
(3-chlorophenyl)methyl N-[(2R)-1-[[1-diethoxyphosphoryl-1-hydroxy-3-(2-oxo-1-azaspiro[4.5]decan-3-yl)propan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 156883725) has the molecular formula C30H47ClN3O8P and a molecular weight of 644.15 g/mol. Its IUPAC name is (3-chlorophenyl)methyl N-[(2R)-1-[[1-diethoxyphosphoryl-1-hydroxy-3-(2-oxo-1-azaspiro[4.5]decan-3-yl)propan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | (3-chlorophenyl)methyl N-[(2R)-1-[[1-diethoxyphosphoryl-1-hydroxy-3-(2-oxo-1-azaspiro[4.5]decan-3-yl)propan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 156883725 |
| Molecular Formula | C30H47ClN3O8P |
| Molecular Weight | 644.15 g/mol |
| Exact Mass | 643.28 |
| IUPAC Name | (3-chlorophenyl)methyl N-[(2R)-1-[[1-diethoxyphosphoryl-1-hydroxy-3-(2-oxo-1-azaspiro[4.5]decan-3-yl)propan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCOP(=O)(OCC)C(O)C(CC1CC2(CCCCC2)NC1=O)NC(=O)[C@@H](CC(C)C)NC(=O)OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C30H47ClN3O8P/c1-5-41-43(39,42-6-2)28(37)25(17-22-18-30(34-26(22)35)13-8-7-9-14-30)32-27(36)24(15-20(3)4)33-29(38)40-19-21-11-10-12-23(31)16-21/h10-12,16,20,22,24-25,28,37H,5-9,13-15,17-19H2,1-4H3,(H,32,36)(H,33,38)(H,34,35)/t22?,24-,25?,28?/m1/s1 |
| InChIKey | DHGGSKDOHVNJTH-ISNGWWJUSA-N |
| XLogP | 5.28 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.15 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|