C33H48ClN3O5 — CID 156884159
[2-[(3-chlorophenyl)methyl]cyclopentyl] N-[(2S)-3-cyclohexyl-1-[[1-hydroxy-3-(2-oxo-1-azaspiro[4.4]nonan-3-yl)propan-2-yl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 156884159) has the molecular formula C33H48ClN3O5 and a molecular weight of 602.22 g/mol. Its IUPAC name is [2-[(3-chlorophenyl)methyl]cyclopentyl] N-[(2S)-3-cyclohexyl-1-[[1-hydroxy-3-(2-oxo-1-azaspiro[4.4]nonan-3-yl)propan-2-yl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | [2-[(3-chlorophenyl)methyl]cyclopentyl] N-[(2S)-3-cyclohexyl-1-[[1-hydroxy-3-(2-oxo-1-azaspiro[4.4]nonan-3-yl)propan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 156884159 |
| Molecular Formula | C33H48ClN3O5 |
| Molecular Weight | 602.22 g/mol |
| Exact Mass | 601.33 |
| IUPAC Name | [2-[(3-chlorophenyl)methyl]cyclopentyl] N-[(2S)-3-cyclohexyl-1-[[1-hydroxy-3-(2-oxo-1-azaspiro[4.4]nonan-3-yl)propan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](CC1CCCCC1)C(=O)NC(CO)CC1CC2(CCCC2)NC1=O)OC1CCCC1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C33H48ClN3O5/c34-26-12-6-10-23(17-26)16-24-11-7-13-29(24)42-32(41)36-28(18-22-8-2-1-3-9-22)31(40)35-27(21-38)19-25-20-33(37-30(25)39)14-4-5-15-33/h6,10,12,17,22,24-25,27-29,38H,1-5,7-9,11,13-16,18-21H2,(H,35,40)(H,36,41)(H,37,39)/t24?,25?,27?,28-,29?/m0/s1 |
| InChIKey | XNTNDTJRNQSLRQ-BSZMJMFWSA-N |
| XLogP | 5.43 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.22 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |