C31H38ClN3O6 — CID 167435601
ethyl (2S)-2-[[(2S)-2-[[2-[(3-chlorophenyl)methyl]cyclopentyl]oxycarbonylamino]-3-phenylpropanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate (PubChem CID 167435601) has the molecular formula C31H38ClN3O6 and a molecular weight of 584.11 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2S)-2-[[2-[(3-chlorophenyl)methyl]cyclopentyl]oxycarbonylamino]-3-phenylpropanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate.
| Compound Name | ethyl (2S)-2-[[(2S)-2-[[2-[(3-chlorophenyl)methyl]cyclopentyl]oxycarbonylamino]-3-phenylpropanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 167435601 |
| Molecular Formula | C31H38ClN3O6 |
| Molecular Weight | 584.11 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | ethyl (2S)-2-[[(2S)-2-[[2-[(3-chlorophenyl)methyl]cyclopentyl]oxycarbonylamino]-3-phenylpropanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate |
| SMILES | CCOC(=O)[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)OC1CCCC1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C31H38ClN3O6/c1-2-40-30(38)26(19-23-14-15-33-28(23)36)34-29(37)25(18-20-8-4-3-5-9-20)35-31(39)41-27-13-7-11-22(27)16-21-10-6-12-24(32)17-21/h3-6,8-10,12,17,22-23,25-27H,2,7,11,13-16,18-19H2,1H3,(H,33,36)(H,34,37)(H,35,39)/t22?,23-,25-,26-,27?/m0/s1 |
| InChIKey | WKVVBWUMUZJPCA-WCHRPKAPSA-N |
| XLogP | 3.96 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.11 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |