C28H40ClN3O5 — CID 156858155
(3-chlorophenyl)methyl (NE)-N-[3-cyclohexyl-1-[[(2S)-5-[methyl(pentyl)amino]-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-ylidene]carbamate (PubChem CID 156858155) has the molecular formula C28H40ClN3O5 and a molecular weight of 534.10 g/mol. Its IUPAC name is (3-chlorophenyl)methyl (NE)-N-[3-cyclohexyl-1-[[(2S)-5-[methyl(pentyl)amino]-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-ylidene]carbamate.
| Compound Name | (3-chlorophenyl)methyl (NE)-N-[3-cyclohexyl-1-[[(2S)-5-[methyl(pentyl)amino]-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-ylidene]carbamate |
|---|---|
| PubChem CID | 156858155 |
| Molecular Formula | C28H40ClN3O5 |
| Molecular Weight | 534.10 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | (3-chlorophenyl)methyl (NE)-N-[3-cyclohexyl-1-[[(2S)-5-[methyl(pentyl)amino]-1,5-dioxopentan-2-yl]amino]-1-oxopropan-2-ylidene]carbamate |
| SMILES | CCCCCN(C)C(=O)CC[C@@H](C=O)NC(=O)/C(CC1CCCCC1)=N/C(=O)OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C28H40ClN3O5/c1-3-4-8-16-32(2)26(34)15-14-24(19-33)30-27(35)25(18-21-10-6-5-7-11-21)31-28(36)37-20-22-12-9-13-23(29)17-22/h9,12-13,17,19,21,24H,3-8,10-11,14-16,18,20H2,1-2H3,(H,30,35)/b31-25+/t24-/m0/s1 |
| InChIKey | UWBGJKSQXZSLRO-CVJVBRKQSA-N |
| XLogP | 5.50 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.10 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|