C27H39ClN2O5 — CID 166756372
(3-chlorophenyl)methyl N-[(6S)-9-(dimethylamino)-6-formyl-1-(4-methylcyclohexyl)-3,9-dioxononan-2-yl]carbamate (PubChem CID 166756372) has the molecular formula C27H39ClN2O5 and a molecular weight of 507.07 g/mol. Its IUPAC name is (3-chlorophenyl)methyl N-[(6S)-9-(dimethylamino)-6-formyl-1-(4-methylcyclohexyl)-3,9-dioxononan-2-yl]carbamate.
| Compound Name | (3-chlorophenyl)methyl N-[(6S)-9-(dimethylamino)-6-formyl-1-(4-methylcyclohexyl)-3,9-dioxononan-2-yl]carbamate |
|---|---|
| PubChem CID | 166756372 |
| Molecular Formula | C27H39ClN2O5 |
| Molecular Weight | 507.07 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | (3-chlorophenyl)methyl N-[(6S)-9-(dimethylamino)-6-formyl-1-(4-methylcyclohexyl)-3,9-dioxononan-2-yl]carbamate |
| SMILES | CC1CCC(CC(NC(=O)OCc2cccc(Cl)c2)C(=O)CC[C@H](C=O)CCC(=O)N(C)C)CC1 |
| InChI | InChI=1S/C27H39ClN2O5/c1-19-7-9-20(10-8-19)16-24(29-27(34)35-18-22-5-4-6-23(28)15-22)25(32)13-11-21(17-31)12-14-26(33)30(2)3/h4-6,15,17,19-21,24H,7-14,16,18H2,1-3H3,(H,29,34)/t19?,20?,21-,24?/m0/s1 |
| InChIKey | VHASUVCWRXUKLL-ATCWGPEFSA-N |
| XLogP | 5.18 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.07 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|