C29H47N3O4 — CID 154054058
tert-butyl (2R)-2-[(1S,2R)-2-amino-1-hydroxy-3-phenylpropyl]-4-(5-cyclohexylpentanoyl)piperazine-1-carboxylate (PubChem CID 154054058) has the molecular formula C29H47N3O4 and a molecular weight of 501.71 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(1S,2R)-2-amino-1-hydroxy-3-phenylpropyl]-4-(5-cyclohexylpentanoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(1S,2R)-2-amino-1-hydroxy-3-phenylpropyl]-4-(5-cyclohexylpentanoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 154054058 |
| Molecular Formula | C29H47N3O4 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.36 |
| IUPAC Name | tert-butyl (2R)-2-[(1S,2R)-2-amino-1-hydroxy-3-phenylpropyl]-4-(5-cyclohexylpentanoyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)CCCCC2CCCCC2)C[C@@H]1[C@@H](O)[C@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C29H47N3O4/c1-29(2,3)36-28(35)32-19-18-31(26(33)17-11-10-14-22-12-6-4-7-13-22)21-25(32)27(34)24(30)20-23-15-8-5-9-16-23/h5,8-9,15-16,22,24-25,27,34H,4,6-7,10-14,17-21,30H2,1-3H3/t24-,25-,27+/m1/s1 |
| InChIKey | NHTIUQYRMXECAX-SLQPCKNISA-N |
| XLogP | 4.51 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|