C24H28N4O3S — CID 15906447
(2S)-2-[(4-aminophenyl)sulfonyl-methylamino]-N-methyl-3-phenyl-N-(2-pyridin-2-ylethyl)propanamide (PubChem CID 15906447) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is (2S)-2-[(4-aminophenyl)sulfonyl-methylamino]-N-methyl-3-phenyl-N-(2-pyridin-2-ylethyl)propanamide.
| Compound Name | (2S)-2-[(4-aminophenyl)sulfonyl-methylamino]-N-methyl-3-phenyl-N-(2-pyridin-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 15906447 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (2S)-2-[(4-aminophenyl)sulfonyl-methylamino]-N-methyl-3-phenyl-N-(2-pyridin-2-ylethyl)propanamide |
| SMILES | CN(CCc1ccccn1)C(=O)[C@H](Cc1ccccc1)N(C)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C24H28N4O3S/c1-27(17-15-21-10-6-7-16-26-21)24(29)23(18-19-8-4-3-5-9-19)28(2)32(30,31)22-13-11-20(25)12-14-22/h3-14,16,23H,15,17-18,25H2,1-2H3/t23-/m0/s1 |
| InChIKey | NSDIPPVJTFHASW-QHCPKHFHSA-N |
| XLogP | 2.60 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|