C18H21NO3 — CID 151598616
butyl N-(1-naphthalen-2-yl-3-oxopropan-2-yl)carbamate (PubChem CID 151598616) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is butyl N-(1-naphthalen-2-yl-3-oxopropan-2-yl)carbamate.
| Compound Name | butyl N-(1-naphthalen-2-yl-3-oxopropan-2-yl)carbamate |
|---|---|
| PubChem CID | 151598616 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | butyl N-(1-naphthalen-2-yl-3-oxopropan-2-yl)carbamate |
| SMILES | CCCCOC(=O)NC(C=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H21NO3/c1-2-3-10-22-18(21)19-17(13-20)12-14-8-9-15-6-4-5-7-16(15)11-14/h4-9,11,13,17H,2-3,10,12H2,1H3,(H,19,21) |
| InChIKey | QJZSBJDDWXXZAN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|