C17H24FN3O2 — CID 4647403
propan-2-yl N-(4-fluorobenzoyl)-N'-(2-pyrrolidin-1-ylethyl)carbamimidate (PubChem CID 4647403) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is propan-2-yl N-(4-fluorobenzoyl)-N'-(2-pyrrolidin-1-ylethyl)carbamimidate.
| Compound Name | propan-2-yl N-(4-fluorobenzoyl)-N'-(2-pyrrolidin-1-ylethyl)carbamimidate |
|---|---|
| PubChem CID | 4647403 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | propan-2-yl N-(4-fluorobenzoyl)-N'-(2-pyrrolidin-1-ylethyl)carbamimidate |
| SMILES | CC(C)O/C(=N\CCN1CCCC1)NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H24FN3O2/c1-13(2)23-17(19-9-12-21-10-3-4-11-21)20-16(22)14-5-7-15(18)8-6-14/h5-8,13H,3-4,9-12H2,1-2H3,(H,19,20,22) |
| InChIKey | KVCJTFPTJAGONJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|