C19H29N3O4 — CID 7338693
2-methoxyethyl N-(3-methoxybenzoyl)-N'-(2-piperidin-1-ylethyl)carbamimidate (PubChem CID 7338693) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-methoxyethyl N-(3-methoxybenzoyl)-N'-(2-piperidin-1-ylethyl)carbamimidate.
| Compound Name | 2-methoxyethyl N-(3-methoxybenzoyl)-N'-(2-piperidin-1-ylethyl)carbamimidate |
|---|---|
| PubChem CID | 7338693 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 2-methoxyethyl N-(3-methoxybenzoyl)-N'-(2-piperidin-1-ylethyl)carbamimidate |
| SMILES | COCCO/C(=N\CCN1CCCCC1)NC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C19H29N3O4/c1-24-13-14-26-19(20-9-12-22-10-4-3-5-11-22)21-18(23)16-7-6-8-17(15-16)25-2/h6-8,15H,3-5,9-14H2,1-2H3,(H,20,21,23) |
| InChIKey | FJOXZQAOKUPGSB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|