C16H25N3O3 — CID 7482397
propan-2-yl N'-[2-(dimethylamino)ethyl]-N-(4-methoxybenzoyl)carbamimidate (PubChem CID 7482397) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is propan-2-yl N'-[2-(dimethylamino)ethyl]-N-(4-methoxybenzoyl)carbamimidate.
| Compound Name | propan-2-yl N'-[2-(dimethylamino)ethyl]-N-(4-methoxybenzoyl)carbamimidate |
|---|---|
| PubChem CID | 7482397 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | propan-2-yl N'-[2-(dimethylamino)ethyl]-N-(4-methoxybenzoyl)carbamimidate |
| SMILES | COc1ccc(C(=O)N/C(=N/CCN(C)C)OC(C)C)cc1 |
| InChI | InChI=1S/C16H25N3O3/c1-12(2)22-16(17-10-11-19(3)4)18-15(20)13-6-8-14(21-5)9-7-13/h6-9,12H,10-11H2,1-5H3,(H,17,18,20) |
| InChIKey | LRMWIRYKMOVZLR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|