C21H26N2O5 — CID 7419564
ethyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(4-methoxybenzoyl)carbamimidate (PubChem CID 7419564) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is ethyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(4-methoxybenzoyl)carbamimidate.
| Compound Name | ethyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(4-methoxybenzoyl)carbamimidate |
|---|---|
| PubChem CID | 7419564 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | ethyl N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-(4-methoxybenzoyl)carbamimidate |
| SMILES | CCO/C(=N\CCc1ccc(OC)c(OC)c1)NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-5-28-21(23-20(24)16-7-9-17(25-2)10-8-16)22-13-12-15-6-11-18(26-3)19(14-15)27-4/h6-11,14H,5,12-13H2,1-4H3,(H,22,23,24) |
| InChIKey | JXRFBHZRAXCINE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|