C19H23N3O5 — CID 22149264
4-methoxy-N-[N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]benzamide (PubChem CID 22149264) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 4-methoxy-N-[N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]benzamide.
| Compound Name | 4-methoxy-N-[N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 22149264 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 4-methoxy-N-[N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]benzamide |
| SMILES | COc1ccc(C(=O)N/C(N)=N/Cc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H23N3O5/c1-24-14-7-5-13(6-8-14)18(23)22-19(20)21-11-12-9-15(25-2)17(27-4)16(10-12)26-3/h5-10H,11H2,1-4H3,(H3,20,21,22,23) |
| InChIKey | ONBGSUODCTZSMN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|